Repositioning Candidate Details
| Candidate ID: | R0466 |
| Source ID: | DB07715 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Emodin |
| Synonyms: | |
| Molecular Formula: | C15H10O5 |
| SMILES: | CC1=CC(O)=C2C(=O)C3=C(C=C(O)C=C3O)C(=O)C2=C1 |
| Structure: |
|
| DrugBank Description: | Emodin has been investigated for the treatment of Polycystic Kidney. |
| CAS Number: | 518-82-1 |
| Molecular Weight: | 270.2369 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | Casein kinase II subunit alpha; Putative ketoacyl reductase; 3-hydroxyacyl-[acyl-carrier-protein] dehydratase FabZ; Aryl hydrocarbon receptor |
| Inclusion Criteria: |

| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|