Repositioning Candidate Details
| Candidate ID: | R0480 |
| Source ID: | DB08997 |
| Source Type: | withdrawn |
| Compound Type: | small molecule |
| Compound Name: | Dexetimide |
| Synonyms: | |
| Molecular Formula: | C23H26N2O2 |
| SMILES: | OC1=NC(=O)[C@@](CC1)(C1CCN(CC2=CC=CC=C2)CC1)C1=CC=CC=C1 |
| Structure: |
|
| DrugBank Description: | A muscarinic antagonist that has been used to treat neuroleptic-induced parkinsonism. Benzetimide is the (-)-enantimorph of dexetimide. |
| CAS Number: | 21888-98-2 |
| Molecular Weight: | 362.4647 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|