Repositioning Candidate Details
| Candidate ID: | R0505 |
| Source ID: | DB11674 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Equol |
| Synonyms: | |
| Molecular Formula: | C15H14O3 |
| SMILES: | OC1=CC=C(C=C1)[C@H]1COC2=C(C1)C=CC(O)=C2 |
| Structure: |
|
| DrugBank Description: | Equol has been used in trials studying the treatment of Breast Cancer. |
| CAS Number: | 531-95-3 |
| Molecular Weight: | 242.2699 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | Estrogen receptor beta; Sex hormone-binding globulin |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|