Repositioning Candidate Details
| Candidate ID: | R0507 |
| Source ID: | DB11742 |
| Source Type: | approved; investigational |
| Compound Type: | small molecule |
| Compound Name: | Ebastine |
| Synonyms: | |
| Molecular Formula: | C32H39NO2 |
| SMILES: | CC(C)(C)C1=CC=C(C=C1)C(=O)CCCN1CCC(CC1)OC(C1=CC=CC=C1)C1=CC=CC=C1 |
| Structure: |
|
| DrugBank Description: | Ebastine is under investigation for the treatment of Irritable Bowel Syndrome (IBS). Ebastine has been investigated for the treatment of Urticaria. |
| CAS Number: | 90729-43-4 |
| Molecular Weight: | 469.6576 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|