Repositioning Candidate Details
| Candidate ID: | R0509 |
| Source ID: | DB11783 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Imidapril |
| Synonyms: | |
| Molecular Formula: | C20H27N3O6 |
| SMILES: | [H][C@@](C)(N[C@@]([H])(CCC1=CC=CC=C1)C(=O)OCC)C(=O)N1C(=O)N(C)C[C@@]1([H])C(O)=O |
| Structure: |
|
| DrugBank Description: | Imidapril has been investigated for the treatment of Kidney, Polycystic, Autosomal Dominant. |
| CAS Number: | 89371-37-9 |
| Molecular Weight: | 405.4449 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|