Repositioning Candidate Details
| Candidate ID: | R0511 |
| Source ID: | DB11873 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Verinurad |
| Synonyms: | |
| Molecular Formula: | C20H16N2O2S |
| SMILES: | CC(C)(SC1=CC=NC=C1C1=C2C=CC=CC2=C(C=C1)C#N)C(O)=O |
| Structure: |
|
| DrugBank Description: | Verinurad has been used in trials studying the basic science and treatment of Gout, Gout and Hyperuricemia, and Gout and Asymptomatic Hyperuricemia. |
| CAS Number: | 1352792-74-5 |
| Molecular Weight: | 348.42 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|