Repositioning Candidate Details
| Candidate ID: | R0513 |
| Source ID: | DB12112 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Zuretinol acetate |
| Synonyms: | |
| Molecular Formula: | C22H32O2 |
| SMILES: | CC(=O)OC\C=C(/C)\C=C\C=C(\C)/C=C/C1=C(C)CCCC1(C)C |
| Structure: |
|
| DrugBank Description: | Zuretinol acetate has been used in trials studying the treatment of Impaired Dark Adaptation, RP (Retinitis Pigmentosa), Retinitis Pigmentosa (RP), and LCA (Leber Congenital Amaurosis). |
| CAS Number: | 29584-22-3 |
| Molecular Weight: | 328.4883 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|