Repositioning Candidate Details
| Candidate ID: | R0514 |
| Source ID: | DB12126 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Bradykinin |
| Synonyms: | |
| Molecular Formula: | C50H73N15O11 |
| SMILES: | N[C@@H](CCCNC(N)=N)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)NCC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O |
| Structure: |
|
| DrugBank Description: | Bradykinin has been investigated for the basic science and treatment of Hypertension and Diabetes Type 2. |
| CAS Number: | 58-82-2 |
| Molecular Weight: | 1060.2085 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|