Repositioning Candidate Details
| Candidate ID: | R0515 |
| Source ID: | DB12163 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Sarpogrelate |
| Synonyms: | |
| Molecular Formula: | C24H31NO6 |
| SMILES: | COC1=CC(CCC2=CC=CC=C2OCC(CN(C)C)OC(=O)CCC(O)=O)=CC=C1 |
| Structure: |
|
| DrugBank Description: | Sarpogrelate has been investigated for the treatment of Diabetes Mellitus, Diabetic Nephropathy, Coronary Artery Disease, and Renal Insufficiency, Chronic. |
| CAS Number: | 125926-17-2 |
| Molecular Weight: | 429.513 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | 5-hydroxytryptamine receptor 2C; 5-hydroxytryptamine receptor 2A |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|