Repositioning Candidate Details
| Candidate ID: | R0518 |
| Source ID: | DB12319 |
| Source Type: | investigational; withdrawn |
| Compound Type: | small molecule |
| Compound Name: | Benzbromarone |
| Synonyms: | |
| Molecular Formula: | C17H12Br2O3 |
| SMILES: | CCC1=C(C(=O)C2=CC(Br)=C(O)C(Br)=C2)C2=CC=CC=C2O1 |
| Structure: |
|
| DrugBank Description: | Benzbromarone has been used in trials studying the basic science and treatment of Heart Failure, Hyperuricemia, Chronic Kidney Disease, Abnormal Renal Function, and Gout and Asymptomatic Hyperuricemia. |
| CAS Number: | 3562-84-3 |
| Molecular Weight: | 424.083 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | Cytochrome P450 2C9; Cytochrome P450 2C19 |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|