Repositioning Candidate Details
| Candidate ID: | R0519 |
| Source ID: | DB12445 |
| Source Type: | investigational |
| Compound Type: | small molecule |
| Compound Name: | Nitroaspirin |
| Synonyms: | |
| Molecular Formula: | C16H13NO7 |
| SMILES: | CC(=O)OC1=CC=CC=C1C(=O)OC1=CC=CC(CO[N+]([O-])=O)=C1 |
| Structure: |
|
| DrugBank Description: | Nitroaspirin has been investigated for the treatment of Intermittent Claudication. |
| CAS Number: | 175033-36-0 |
| Molecular Weight: | 331.28 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | Prostaglandin G/H synthase 1 |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|