Repositioning Candidate Details
| Candidate ID: | R0541 |
| Source ID: | DB14681 |
| Source Type: | experimental |
| Compound Type: | small molecule |
| Compound Name: | Cortisone |
| Synonyms: | |
| Molecular Formula: | C21H28O5 |
| SMILES: | [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)CC(=O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)CC[C@]12C |
| Structure: |
|
| DrugBank Description: | A naturally occurring glucocorticoid. It has been used in replacement therapy for adrenal insufficiency and as an anti-inflammatory agent. Cortisone itself is inactive. It is converted in the liver to the active metabolite hydrocortisone. (From Martindale, The Extra Pharmacopoeia, 30th ed, p726) |
| CAS Number: | 53-06-5 |
| Molecular Weight: | 360.444 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | |
| Inclusion Criteria: |
| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|