Repositioning Candidate Details
| Candidate ID: | R0543 |
| Source ID: | DB14761 |
| Source Type: | experimental |
| Compound Type: | small molecule |
| Compound Name: | Remdesivir |
| Synonyms: | |
| Molecular Formula: | C27H35N6O8P |
| SMILES: | CCC(CC)COC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@](C#N)([C@H](O)[C@@H]1O)C1=CC=C2N1N=CN=C2N)OC1=CC=CC=C1 |
| Structure: |
|
| DrugBank Description: | |
| CAS Number: | 1809249-37-3 |
| Molecular Weight: | 602.585 |
| DrugBank Indication: | |
| DrugBank Pharmacology: | |
| DrugBank MoA: | |
| Targets: | NA; Replicase polyprotein 1ab; NA; NA |
| Inclusion Criteria: |

| Strategy ID | Strategy | Synonyms | Related Targets | Related Drugs |
|---|
| Target ID | Target Name | GENE | Action | Class | UniProtKB ID | Entry Name |
|---|
| Diseases ID | DO ID | Disease Name | Definition | Class |
|---|