CMap Candidate Details
Structure:
| CMap ID: | C01066 |
| Pert ID: | BRD-K20338176 |
| Compound Name: | cefaclor |
| Targets: | |
| MoA: | bacterial cell wall synthesis inhibitor |
| SMILES: | N[C@@H](C(=O)N[C@H]1[C@H]2SCC(Cl)=C(N2C1=O)C(O)=O)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 22114 | BRD-K20338176 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 22451 | BRD-K20338176 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.34 | 1.19 | 1.03 |
| 22720 | BRD-K20338176 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 23003 | BRD-K20338176 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.26 | 1.29 |
| 24132 | BRD-K20338176 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51707 | BRD-K20338176 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51811 | BRD-K20338176 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |