CMap Candidate Details
Structure:
| CMap ID: | C01273 |
| Pert ID: | BRD-K14704277 |
| Compound Name: | cinoxacin |
| Targets: | |
| MoA: | topoisomerase inhibitor |
| SMILES: | CCn1nc(C(O)=O)c(=O)c2cc3OCOc3cc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 100119 | BRD-K14704277 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122260 | BRD-K14704277 | A375 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.25 |
| 122366 | BRD-K14704277 | MCF10A | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 122483 | BRD-K14704277 | THP1 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130563 | BRD-K14704277 | A549 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130596 | BRD-K14704277 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.07 | 0.76 |
| 130630 | BRD-K14704277 | HEK293 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130675 | BRD-K14704277 | HELA | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130715 | BRD-K14704277 | HT29 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130764 | BRD-K14704277 | MCF??7.00 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.82 | 0.15 |
| 130789 | BRD-K14704277 | MDAMB231 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130817 | BRD-K14704277 | PC3 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.79 | 0.1 |
| 130842 | BRD-K14704277 | YAPC | 2.22 uM | 24 h | -0.3 | -1.23 | 0.64 | 0.0 | 0.0 | 0.0 |