CMap Candidate Details
Structure:
| CMap ID: | C01279 |
| Pert ID: | BRD-A49358627 |
| Compound Name: | ciprofibrate |
| Targets: | PPARA |
| MoA: | PPAR receptor agonist |
| SMILES: | CC(C)(Oc1ccc(cc1)C1CC1(Cl)Cl)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1694 | BRD-A49358627 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.83 | 0.17 |
| 1829 | BRD-A49358627 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2281 | BRD-A49358627 | PC3 | 10 uM | 24 h | -0.24 | -1.0 | 0.14 | -0.3 | -1.01 | 0.57 |
| 2763 | BRD-A49358627 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41672 | BRD-A49358627 | A375 | 10 uM | 6 h | -0.27 | -1.12 | 0.38 | 0.0 | 0.0 | 0.0 |
| 42014 | BRD-A49358627 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42212 | BRD-A49358627 | ASC | 10 uM | 24 h | -0.21 | -0.87 | 0.02 | -0.24 | -0.8 | 0.12 |
| 42862 | BRD-A49358627 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43413 | BRD-A49358627 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.34 | 1.2 | 1.13 |
| 43723 | BRD-A49358627 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.2 | 1.22 |
| 52095 | BRD-A49358627 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52947 | BRD-A49358627 | HEPG2 | 20 uM | 3 h | -0.24 | -0.99 | 0.13 | 0.0 | 0.0 | 0.0 |