CMap Candidate Details
Structure:
| CMap ID: | C01313 |
| Pert ID: | BRD-A46066006 |
| Compound Name: | clidinium |
| Targets: | CHRM1|CHRM3 |
| MoA: | acetylcholine receptor antagonist |
| SMILES: | C[N+]12CCC(CC1)C(C2)OC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 100176 | BRD-A46066006 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |