CMap Candidate Details
Structure:
| CMap ID: | C01329 |
| Pert ID: | BRD-K56614220 |
| Compound Name: | clofazimine |
| Targets: | |
| MoA: | GK0582 inhibitor |
| SMILES: | CC(C)\N=c1/cc2n(-c3ccc(Cl)cc3)c3ccccc3nc2cc1Nc1ccc(Cl)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24457 | BRD-K56614220 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24589 | BRD-K56614220 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25394 | BRD-K56614220 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123533 | BRD-K56614220 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.79 | 0.11 |
| 123560 | BRD-K56614220 | HEK293 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123612 | BRD-K56614220 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123639 | BRD-K56614220 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123678 | BRD-K56614220 | MCF10A | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.21 | 0.76 | 0.05 |
| 123759 | BRD-K56614220 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132073 | BRD-K56614220 | MCF??7.00 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132103 | BRD-K56614220 | PC3 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |