CMap Candidate Details
Structure:
| CMap ID: | C01379 |
| Pert ID: | BRD-K61195623 |
| Compound Name: | combretastatin-A-4 |
| Targets: | |
| MoA: | tubulin polymerization inhibitor |
| SMILES: | COc1ccc(cc1O)\C=C/c1cc(OC)c(OC)c(OC)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 123816 | BRD-K61195623 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123857 | BRD-K61195623 | A549 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 123926 | BRD-K61195623 | HEK293 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.56 |
| 124028 | BRD-K61195623 | JURKAT | 10 uM | 24 h | -0.16 | -0.68 | 0.0 | -0.26 | -0.87 | 0.23 |
| 124079 | BRD-K61195623 | MCF10A | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124157 | BRD-K61195623 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124209 | BRD-K61195623 | THP1 | 0.37 uM | 24 h | -0.28 | -1.15 | 0.43 | -0.28 | -0.93 | 0.34 |
| 124262 | BRD-K61195623 | YAPC | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132180 | BRD-K61195623 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.97 | 0.36 |
| 132212 | BRD-K61195623 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.76 | 0.07 |
| 132244 | BRD-K61195623 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.88 | 0.25 |
| 132267 | BRD-K61195623 | MCF??7.00 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.08 | 0.8 |
| 132281 | BRD-K61195623 | MDAMB231 | 0.08 uM | 24 h | -0.17 | -0.69 | 0.0 | 0.0 | 0.0 | 0.0 |