CMap Candidate Details
Structure:
| CMap ID: | C01497 |
| Pert ID: | BRD-K23363278 |
| Compound Name: | CYT-997 |
| Targets: | TUBB |
| MoA: | tubulin polymerization inhibitor |
| SMILES: | CCC[C@H](Nc1nc(ncc1C)-c1ccc(NC(=O)NCC)c(OC)c1)c1cccnc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 9387 | BRD-K23363278 | AGS | 1.11 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.06 | 0.75 |
| 9699 | BRD-K23363278 | H1299 | 1.11 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.4 | -1.34 | 1.86 |
| 10244 | BRD-K23363278 | HCC515 | 1.11 uM | 6 h | -0.24 | -1.0 | 0.15 | 0.0 | 0.0 | 0.0 |
| 10759 | BRD-K23363278 | HEPG2 | 1.11 uM | 6 h | -0.24 | -1.01 | 0.16 | 0.0 | 0.0 | 0.0 |
| 11449 | BRD-K23363278 | NCIH2073 | 1.11 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 12014 | BRD-K23363278 | NCIH596 | 1.11 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 12290 | BRD-K23363278 | NOMO1 | 1.11 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.16 | 1.09 |
| 12426 | BRD-K23363278 | PC3 | 1.11 uM | 24 h | -0.28 | -1.16 | 0.45 | -0.28 | -0.94 | 0.37 |
| 12761 | BRD-K23363278 | SW480 | 1.11 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 12924 | BRD-K23363278 | THP1 | 1.11 uM | 6 h | 0.2 | 0.83 | 0.0 | -0.25 | -0.86 | 0.21 |
| 13241 | BRD-K23363278 | U937 | 1.11 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.95 | 0.42 |
| 13460 | BRD-K23363278 | VCAP | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120957 | BRD-K23363278 | HEK293 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121045 | BRD-K23363278 | MCF??7.00 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.24 | 0.84 | 0.12 |
| 121113 | BRD-K23363278 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129098 | BRD-K23363278 | A375 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129117 | BRD-K23363278 | A549 | 2.22 uM | 24 h | -0.24 | -0.98 | 0.12 | -0.29 | -0.99 | 0.5 |
| 129137 | BRD-K23363278 | HA1E | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129165 | BRD-K23363278 | HELA | 2.22 uM | 3 h | 0.0 | 0.0 | 0.0 | -0.47 | -1.57 | 15.65 |
| 129192 | BRD-K23363278 | HT29 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.04 | 0.65 |