CMap Candidate Details
Structure:
| CMap ID: | C01795 |
| Pert ID: | BRD-K92093830 |
| Compound Name: | doxorubicin |
| Targets: | TOP2A |
| MoA: | topoisomerase inhibitor |
| SMILES: | COc1cccc2C(=O)c3c(O)c4C[C@](O)(C[C@H](O[C@H]5C[C@H](N)[C@H](O)[C@H](C)O5)c4c(O)c3C(=O)c12)C(=O)CO |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4259 | BRD-K92093830 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.19 | 0.67 | 0.01 |
| 4827 | BRD-K92093830 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.36 | 1.29 | 1.49 |
| 25543 | BRD-K92093830 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37198 | BRD-K92093830 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37760 | BRD-K92093830 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37957 | BRD-K92093830 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39021 | BRD-K92093830 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51646 | BRD-K92093830 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90558 | BRD-K92093830 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90874 | BRD-K92093830 | MCF10A | 1.11 uM | 3 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 117144 | BRD-K92093830 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127876 | BRD-K92093830 | HEK293 | 0.37 uM | 24 h | 0.2 | 0.84 | 0.0 | -0.32 | -1.07 | 0.75 |
| 127950 | BRD-K92093830 | HUVEC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128084 | BRD-K92093830 | YAPC | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.22 | 0.79 | 0.07 |
| 135577 | BRD-K92093830 | HELA | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135619 | BRD-K92093830 | HT29 | 0.01 uM | 24 h | -0.3 | -1.24 | 0.65 | 0.0 | 0.0 | 0.0 |
| 135668 | BRD-K92093830 | JURKAT | 0.25 uM | 24 h | 0.28 | 1.16 | 0.35 | 0.0 | 0.0 | 0.0 |