CMap Candidate Details
Structure:
| CMap ID: | C01821 |
| Pert ID: | BRD-K08859203 |
| Compound Name: | DU-728 |
| Targets: | ITGA2B|ITGB3 |
| MoA: | structural glycoprotein antagonist |
| SMILES: | N[C@@H](CCCNC(N)=N)C(=O)NCC(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CO)C(O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 121146 | BRD-K08859203 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.23 | -0.76 | 0.07 |
| 121183 | BRD-K08859203 | A549 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.24 |
| 121219 | BRD-K08859203 | HA1E | 0.125 uM | 24 h | -0.27 | -1.12 | 0.38 | 0.18 | 0.63 | 0.0 |
| 121266 | BRD-K08859203 | HELA | 1.11 uM | 3 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.99 | 0.5 |
| 121309 | BRD-K08859203 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.27 | 0.94 | 0.29 |
| 121344 | BRD-K08859203 | YAPC | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129293 | BRD-K08859203 | HT29 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129328 | BRD-K08859203 | MCF??7.00 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.0 | 0.55 |