CMap Candidate Details
Structure:
| CMap ID: | C01826 |
| Pert ID: | BRD-K72259270 |
| Compound Name: | dyclonine |
| Targets: | SCN10A|SCN5A |
| MoA: | sodium channel blocker |
| SMILES: | CCCCOc1ccc(cc1)C(=O)CCN1CCCCC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51238 | BRD-K72259270 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.0 | 0.55 |
| 51503 | BRD-K72259270 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.27 |