CMap Candidate Details
Structure:
| CMap ID: | C01923 |
| Pert ID: | BRD-K08206212 |
| Compound Name: | entecavir |
| Targets: | |
| MoA: | DNA replication inhibitor; nucleoside reverse transcriptase inhibitor |
| SMILES: | Nc1nc(=O)c2ncn([C@H]3C[C@H](O)[C@@H](CO)C3=C)c2[nH]1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 33774 | BRD-K08206212 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 34040 | BRD-K08206212 | ASC | 10 uM | 24 h | -0.24 | -1.02 | 0.17 | 0.0 | 0.0 | 0.0 |
| 34554 | BRD-K08206212 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.1 | 0.86 |
| 34823 | BRD-K08206212 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 35725 | BRD-K08206212 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.2 | 1.17 |
| 36198 | BRD-K08206212 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 36491 | BRD-K08206212 | SKB | 10 uM | 24 h | -0.17 | -0.7 | 0.0 | -0.32 | -1.09 | 0.81 |
| 36771 | BRD-K08206212 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96509 | BRD-K08206212 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121213 | BRD-K08206212 | HA1E | 10 uM | 24 h | -0.24 | -1.02 | 0.18 | 0.0 | 0.0 | 0.0 |
| 121247 | BRD-K08206212 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.48 | 1.69 | 2.51 |
| 129241 | BRD-K08206212 | A375 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.93 | 0.28 |
| 129288 | BRD-K08206212 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129324 | BRD-K08206212 | MCF??7.00 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.2 | 0.72 | 0.02 |
| 129361 | BRD-K08206212 | YAPC | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |