CMap Candidate Details
Structure:
| CMap ID: | C02052 |
| Pert ID: | BRD-K55055802 |
| Compound Name: | etomidate |
| Targets: | ADRA2B|GABRA1|GABRA2|GABRA3|GABRA4|GABRA5|GABRA6|GABRB1|GABRB2|GABRB3|GABRD|GABRE|GABRG1|GABRG2|GABRG3|GABRP|GABRQ |
| MoA: | GABA receptor modulator |
| SMILES: | CCOC(=O)c1cncn1[C@H](C)c1ccccc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24454 | BRD-K55055802 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24683 | BRD-K55055802 | A549 | 10 uM | 6 h | 0.2 | 0.85 | 0.01 | -0.3 | -1.0 | 0.52 |
| 24790 | BRD-K55055802 | HA1E | 10 uM | 6 h | 0.32 | 1.34 | 0.89 | 0.0 | 0.0 | 0.0 |
| 24922 | BRD-K55055802 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25031 | BRD-K55055802 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25253 | BRD-K55055802 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25521 | BRD-K55055802 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.24 |