CMap Candidate Details
Structure:
| CMap ID: | C02057 |
| Pert ID: | BRD-K54770957 |
| Compound Name: | etoricoxib |
| Targets: | PTGS2 |
| MoA: | cyclooxygenase inhibitor |
| SMILES: | Cc1ccc(cn1)-c1ncc(Cl)cc1-c1ccc(cc1)S(C)(=O)=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91196 | BRD-K54770957 | HUH7 | 10 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124304 | BRD-K54770957 | HA1E | 10 uM | 24 h | 0.17 | 0.71 | 0.0 | -0.26 | -0.89 | 0.26 |
| 124388 | BRD-K54770957 | HT29 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.25 |
| 124425 | BRD-K54770957 | JURKAT | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124492 | BRD-K54770957 | MDAMB231 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 124522 | BRD-K54770957 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132336 | BRD-K54770957 | A375 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.34 | 1.22 | 1.15 |
| 132363 | BRD-K54770957 | A549 | 2.22 uM | 24 h | -0.31 | -1.28 | 0.76 | -0.23 | -0.77 | 0.08 |
| 132428 | BRD-K54770957 | HEK293 | 0.25 uM | 24 h | -0.25 | -1.03 | 0.19 | 0.25 | 0.9 | 0.21 |
| 132447 | BRD-K54770957 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132499 | BRD-K54770957 | MCF10A | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.06 | 0.73 |
| 132527 | BRD-K54770957 | MCF??7.00 | 2.22 uM | 24 h | -0.35 | -1.45 | 1.43 | 0.34 | 1.19 | 1.01 |
| 132613 | BRD-K54770957 | THP1 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 132645 | BRD-K54770957 | YAPC | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |