CMap Candidate Details
Structure:
| CMap ID: | C02148 |
| Pert ID: | BRD-A63752151 |
| Compound Name: | fidarestat |
| Targets: | AKR1B1 |
| MoA: | aldose reductase inhibitor |
| SMILES: | NC(=O)C1CC2(NC(=O)NC2=O)c2cc(F)ccc2O1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 124937 | BRD-A63752151 | A375 | 3.33 uM | 24 h | -0.22 | -0.91 | 0.05 | -0.27 | -0.92 | 0.34 |
| 124965 | BRD-A63752151 | A549 | 0.37 uM | 24 h | -0.24 | -1.01 | 0.17 | -0.31 | -1.04 | 0.67 |
| 125026 | BRD-A63752151 | HELA | 3.33 uM | 24 h | 0.26 | 1.08 | 0.21 | 0.0 | 0.0 | 0.0 |
| 125096 | BRD-A63752151 | MCF??7.00 | 0.37 uM | 24 h | -0.23 | -0.94 | 0.08 | 0.0 | 0.0 | 0.0 |
| 125163 | BRD-A63752151 | THP1 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 125207 | BRD-A63752151 | YAPC | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.98 | 0.49 |
| 133014 | BRD-A63752151 | HA1E | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133049 | BRD-A63752151 | HEK293 | 0.25 uM | 24 h | -0.23 | -0.97 | 0.11 | 0.3 | 1.06 | 0.6 |
| 133117 | BRD-A63752151 | HT29 | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133156 | BRD-A63752151 | JURKAT | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133197 | BRD-A63752151 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 133261 | BRD-A63752151 | MDAMB231 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.38 |
| 133292 | BRD-A63752151 | PC3 | 0.03 uM | 24 h | 0.28 | 1.19 | 0.41 | 0.0 | 0.0 | 0.0 |