CMap Candidate Details
Structure:
| CMap ID: | C02180 |
| Pert ID: | BRD-K86003836 |
| Compound Name: | flubendazole |
| Targets: | TUBB |
| MoA: | tubulin polymerization inhibitor |
| SMILES: | COC(=O)Nc1nc2cc(ccc2[nH]1)C(=O)c1ccc(F)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24494 | BRD-K86003836 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.79 | 0.11 |
| 24619 | BRD-K86003836 | A549 | 10 uM | 24 h | -0.3 | -1.23 | 0.64 | -0.35 | -1.17 | 1.14 |
| 24959 | BRD-K86003836 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25435 | BRD-K86003836 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52205 | BRD-K86003836 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 52341 | BRD-K86003836 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91359 | BRD-K86003836 | HUH7 | 10 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |