CMap Candidate Details
Structure:
| CMap ID: | C02185 |
| Pert ID: | BRD-K71106091 |
| Compound Name: | fludarabine-phosphate |
| Targets: | DCK|POLA1|POLD1|POLE|RRM1|RRM2|RRM2B |
| MoA: | ribonucleotide reductase inhibitor |
| SMILES: | Nc1nc(F)nc2n(cnc12)[C@@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@@H]1O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 117336 | BRD-K71106091 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.18 |
| 117458 | BRD-K71106091 | HCC515 | 10 uM | 24 h | 0.27 | 1.11 | 0.26 | 0.0 | 0.0 | 0.0 |
| 117505 | BRD-K71106091 | HEPG2 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126724 | BRD-K71106091 | HELA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126807 | BRD-K71106091 | MCF10A | 10 uM | 24 h | -0.22 | -0.9 | 0.04 | 0.0 | 0.0 | 0.0 |
| 126847 | BRD-K71106091 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.29 |
| 126891 | BRD-K71106091 | MDAMB231 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.17 | 0.6 | 0.0 |
| 126917 | BRD-K71106091 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 126959 | BRD-K71106091 | THP1 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134706 | BRD-K71106091 | A549 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.73 | 0.05 |
| 134734 | BRD-K71106091 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134769 | BRD-K71106091 | HEK293 | 2.22 uM | 24 h | 0.27 | 1.13 | 0.29 | 0.0 | 0.0 | 0.0 |
| 134830 | BRD-K71106091 | HT29 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134873 | BRD-K71106091 | HUVEC | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 134901 | BRD-K71106091 | JURKAT | 2.22 uM | 24 h | 0.26 | 1.07 | 0.2 | 0.25 | 0.87 | 0.18 |
| 134995 | BRD-K71106091 | YAPC | 0.25 uM | 24 h | 0.26 | 1.1 | 0.24 | 0.0 | 0.0 | 0.0 |