CMap Candidate Details
Structure:
| CMap ID: | C02188 |
| Pert ID: | BRD-K44067360 |
| Compound Name: | flufenamic-acid |
| Targets: | AKR1C3|ANO1|AR|GJA1|GJA10|GJA3|GJA4|GJA5|GJA8|GJA9|GJB1|GJB2|GJB3|GJB4|GJB5|GJB6|GJB7|GJC1|GJC2|GJC3|GJD2|GJD3|GJD4|GJE1|PANX1|PANX2|PANX3|PKD2L1|PTGS1|PTGS2|TRPC5|TRPM2|TRPM5 |
| MoA: | chloride channel blocker |
| SMILES: | OC(=O)c1ccccc1Nc1cccc(c1)C(F)(F)F |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 3027 | BRD-K44067360 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3507 | BRD-K44067360 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 3803 | BRD-K44067360 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44400 | BRD-K44067360 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44588 | BRD-K44067360 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 44965 | BRD-K44067360 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45260 | BRD-K44067360 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 45529 | BRD-K44067360 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.92 | 0.32 |
| 46397 | BRD-K44067360 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.99 | 0.5 |
| 46718 | BRD-K44067360 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51220 | BRD-K44067360 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90977 | BRD-K44067360 | HUH7 | 12 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |