CMap Candidate Details
Structure:
| CMap ID: | C02192 |
| Pert ID: | BRD-A69777949 |
| Compound Name: | flumequine |
| Targets: | |
| MoA: | topoisomerase inhibitor |
| SMILES: | CC1CCc2cc(F)cc3c2n1cc(C(O)=O)c3=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51328 | BRD-A69777949 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.08 | 0.79 |
| 51407 | BRD-A69777949 | PC3 | 10 uM | 24 h | 0.31 | 1.28 | 0.64 | -0.24 | -0.82 | 0.15 |
| 100297 | BRD-A69777949 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |