CMap Candidate Details
Structure:
| CMap ID: | C02207 |
| Pert ID: | BRD-K70487031 |
| Compound Name: | flupentixol |
| Targets: | ADRA1A|CHRM1|DRD1|DRD2|DRD3|DRD5|HTR2A |
| MoA: | dopamine receptor antagonist |
| SMILES: | OCCN1CCN(CC\C=C2\c3ccccc3Sc3ccc(cc23)C(F)(F)F)CC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 4135 | BRD-K70487031 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.37 | 1.31 | 1.59 |
| 4472 | BRD-K70487031 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.01 | 0.45 |
| 4713 | BRD-K70487031 | PC3 | 10 uM | 24 h | 0.19 | 0.78 | 0.0 | 0.31 | 1.1 | 0.69 |
| 5117 | BRD-K70487031 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.25 | 1.35 |
| 39167 | BRD-K70487031 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39480 | BRD-K70487031 | A549 | 10 uM | 6 h | -0.28 | -1.16 | 0.47 | 0.31 | 1.1 | 0.68 |
| 39752 | BRD-K70487031 | ASC | 10 uM | 24 h | -0.25 | -1.04 | 0.21 | -0.37 | -1.26 | 1.35 |
| 40045 | BRD-K70487031 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40312 | BRD-K70487031 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40498 | BRD-K70487031 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.35 | -1.18 | 1.14 |
| 40854 | BRD-K70487031 | NEU | 10 uM | 24 h | 0.21 | 0.88 | 0.01 | 0.25 | 0.88 | 0.18 |
| 41169 | BRD-K70487031 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41507 | BRD-K70487031 | SKB | 10 uM | 24 h | 0.17 | 0.73 | 0.0 | 0.3 | 1.07 | 0.62 |