CMap Candidate Details
Structure:
| CMap ID: | C02264 |
| Pert ID: | BRD-K99383816 |
| Compound Name: | ftorafur |
| Targets: | TYMS |
| MoA: | thymidylate synthase inhibitor |
| SMILES: | Fc1cn([C@H]2CCCO2)c(=O)[nH]c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 95672 | BRD-K99383816 | U2OS | 0.12 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96315 | BRD-K99383816 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.34 | 1.21 | 1.15 |
| 96386 | BRD-K99383816 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127800 | BRD-K99383816 | A549 | 1.11 uM | 24 h | -0.23 | -0.94 | 0.08 | 0.26 | 0.91 | 0.24 |
| 127885 | BRD-K99383816 | HEK293 | 0.04 uM | 24 h | 0.23 | 0.96 | 0.08 | -0.26 | -0.87 | 0.23 |
| 127907 | BRD-K99383816 | HT29 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127959 | BRD-K99383816 | HUVEC | 10 uM | 24 h | 0.28 | 1.15 | 0.34 | 0.27 | 0.96 | 0.34 |
| 128009 | BRD-K99383816 | MCF10A | 10 uM | 24 h | 0.29 | 1.22 | 0.48 | 0.0 | 0.0 | 0.0 |
| 128033 | BRD-K99383816 | MCF??7.00 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.18 |
| 135533 | BRD-K99383816 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135677 | BRD-K99383816 | JURKAT | 0.03 uM | 24 h | 0.29 | 1.19 | 0.42 | 0.0 | 0.0 | 0.0 |
| 135749 | BRD-K99383816 | YAPC | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.4 | -1.35 | 2.02 |