CMap Candidate Details
Structure:
| CMap ID: | C02314 |
| Pert ID: | BRD-K43187018 |
| Compound Name: | GDC-0349 |
| Targets: | PIK3CA |
| MoA: | Pim kinase inhibitor |
| SMILES: | CCNC(=O)Nc1ccc(cc1)-c1nc2CN(CCc2c(n1)N1CCOC[C@@H]1C)C1COC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 90634 | BRD-K43187018 | HCT116 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.43 | 1.52 | 2.29 |
| 90649 | BRD-K43187018 | MCF10A | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 97994 | BRD-K43187018 | HA1E | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 98025 | BRD-K43187018 | MCF??7.00 | 0.37 uM | 24 h | 0.21 | 0.87 | 0.01 | -0.39 | -1.32 | 1.71 |
| 98074 | BRD-K43187018 | P1A82 | 0.37 uM | 24 h | 0.18 | 0.77 | 0.0 | -0.32 | -1.09 | 0.84 |