CMap Candidate Details
Structure:
| CMap ID: | C02576 |
| Pert ID: | BRD-A65767837 |
| Compound Name: | hydrocortisone-acetate |
| Targets: | NR3C1|NR3C2 |
| MoA: | glucocorticoid receptor agonist |
| SMILES: | CC(=O)OCC(=O)[C@@]1(O)CCC2C3CCC4=CC(=O)CC[C@]4(C)C3[C@@H](O)C[C@]12C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6676 | BRD-A65767837 | A375 | 10 uM | 24 h | 0.19 | 0.78 | 0.0 | 0.29 | 1.01 | 0.45 |
| 6947 | BRD-A65767837 | A549 | 10 uM | 24 h | -0.21 | -0.88 | 0.03 | 0.0 | 0.0 | 0.0 |
| 7255 | BRD-A65767837 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.09 | 0.85 |
| 7578 | BRD-A65767837 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7964 | BRD-A65767837 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.24 | -0.79 | 0.11 |
| 8127 | BRD-A65767837 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.2 | 0.7 | 0.01 |
| 8465 | BRD-A65767837 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8610 | BRD-A65767837 | VCAP | 10 uM | 24 h | -0.21 | -0.89 | 0.03 | -0.34 | -1.14 | 1.03 |