CMap Candidate Details
Structure:
| CMap ID: | C02624 |
| Pert ID: | BRD-A74391928 |
| Compound Name: | ibutilide |
| Targets: | CACNA1C|CACNA2D1|CACNB1|CACNG1|KCNH2|KCNH6|KCNH7|KCNJ11|KCNK1|KCNK6 |
| MoA: | potassium channel blocker |
| SMILES: | CCCCCCCN(CC)CCCC(O)c1ccc(NS(C)(=O)=O)cc1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 127356 | BRD-A74391928 | A375 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127429 | BRD-A74391928 | HA1E | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127520 | BRD-A74391928 | JURKAT | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127611 | BRD-A74391928 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127648 | BRD-A74391928 | THP1 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 127690 | BRD-A74391928 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.99 | 0.5 |
| 135346 | BRD-A74391928 | A549 | 0.25 uM | 24 h | -0.25 | -1.05 | 0.23 | 0.27 | 0.97 | 0.35 |
| 135371 | BRD-A74391928 | HELA | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135407 | BRD-A74391928 | HT29 | 2.22 uM | 24 h | 0.21 | 0.86 | 0.01 | 0.0 | 0.0 | 0.0 |
| 135441 | BRD-A74391928 | MCF10A | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 135473 | BRD-A74391928 | MCF??7.00 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.94 | 0.28 |