CMap Candidate Details
Structure:
| CMap ID: | C02645 |
| Pert ID: | BRD-K09638361 |
| Compound Name: | IC261 |
| Targets: | CSNK1A1|CSNK1D|CSNK1E|CSNK1G2 |
| MoA: | casein kinase inhibitor |
| SMILES: | COc1cc(OC)c(\C=C2\C(=O)Nc3ccccc23)c(OC)c1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1736 | BRD-K09638361 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 1881 | BRD-K09638361 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2297 | BRD-K09638361 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.37 | -1.24 | 1.3 |
| 41718 | BRD-K09638361 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.29 | -0.98 | 0.48 |
| 42055 | BRD-K09638361 | A549 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42288 | BRD-K09638361 | ASC | 10 uM | 24 h | 0.22 | 0.91 | 0.03 | 0.0 | 0.0 | 0.0 |
| 42621 | BRD-K09638361 | HEPG2 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 42923 | BRD-K09638361 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43157 | BRD-K09638361 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 43481 | BRD-K09638361 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.41 | -1.38 | 2.02 |
| 43786 | BRD-K09638361 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 90293 | BRD-K09638361 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |