CMap Candidate Details
Structure:
| CMap ID: | C02655 |
| Pert ID: | BRD-K76634210 |
| Compound Name: | idoxuridine |
| Targets: | |
| MoA: | DNA directed DNA polymerase inhibitor |
| SMILES: | OC[C@H]1O[C@H](C[C@@H]1O)n1cc(I)c(=O)[nH]c1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51244 | BRD-K76634210 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51513 | BRD-K76634210 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 91430 | BRD-K76634210 | HUH7 | 10 uM | 72 h | -0.22 | -0.93 | 0.07 | 0.24 | 0.86 | 0.16 |