CMap Candidate Details
Structure:
| CMap ID: | C02947 |
| Pert ID: | BRD-K13474508 |
| Compound Name: | L-655,708 |
| Targets: | GABRA1|GABRA2|GABRA3|GABRA5|GABRG2 |
| MoA: | GABA receptor inverse agonist |
| SMILES: | CCOC(=O)c1ncn-2c1[C@@H]1CCCN1C(=O)c1cc(OC)ccc-21 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 97138 | BRD-K13474508 | A375 | 10 uM | 24 h | 0.22 | 0.91 | 0.03 | -0.29 | -0.97 | 0.45 |
| 97205 | BRD-K13474508 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |