CMap Candidate Details
Structure:
| CMap ID: | C03053 |
| Pert ID: | BRD-K26011976 |
| Compound Name: | licochalcone-a |
| Targets: | PTPN1 |
| MoA: | topoisomerase inhibitor |
| SMILES: | COc1cc(O)c(cc1C=CC(=O)c1ccc(O)cc1)C(C)(C)C=C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 119972 | BRD-K26011976 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120016 | BRD-K26011976 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120067 | BRD-K26011976 | HELA | 10 uM | 3 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120088 | BRD-K26011976 | HT29 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120133 | BRD-K26011976 | MCF??7.00 | 10 uM | 24 h | -0.25 | -1.04 | 0.22 | -0.24 | -0.82 | 0.15 |
| 120174 | BRD-K26011976 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120206 | BRD-K26011976 | YAPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128791 | BRD-K26011976 | A375 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |