CMap Candidate Details
Structure:
| CMap ID: | C03181 |
| Pert ID: | BRD-K27305650 |
| Compound Name: | LY294002 |
| Targets: | AKT1|CHEK1|GSK3B|LCK|MAPK1|MAPK11|MAPK12|MAPK14|MAPK8|MTOR|PIK3CA|PIK3CB|PIK3CD|PIK3CG|PLK1|PRKCA|PRKDC|ROCK1|RPS6KB1|SGK1 |
| MoA: | mTOR inhibitor; PI3K inhibitor; DNA dependent protein kinase inhibitor; phosphodiesterase inhibitor; PLK inhibitor |
| SMILES: | O=c1cc(oc2c(cccc12)-c1ccccc1)N1CCOCC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1239 | BRD-K27305650 | A549 | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 6736 | BRD-K27305650 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.36 | -1.22 | 1.24 |
| 7435 | BRD-K27305650 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.25 | 0.9 | 0.21 |
| 7641 | BRD-K27305650 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7990 | BRD-K27305650 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 59561 | BRD-K27305650 | VCAP | 10 uM | 6 h | 0.18 | 0.77 | 0.0 | -0.35 | -1.18 | 1.14 |
| 82021 | BRD-K27305650 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 88621 | BRD-K27305650 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.89 | 0.26 |
| 95746 | BRD-K27305650 | NPC | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.34 | -1.14 | 1.05 |
| 95915 | BRD-K27305650 | YAPC | 10 uM | 6 h | 0.21 | 0.86 | 0.01 | 0.0 | 0.0 | 0.0 |
| 96066 | BRD-K27305650 | PHH | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 97282 | BRD-K27305650 | HAP1 | 3.33 uM | 24 h | 0.24 | 1.0 | 0.11 | -0.28 | -0.93 | 0.34 |
| 97447 | BRD-K27305650 | NKDBA | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.57 |
| 97810 | BRD-K27305650 | MCF??7.00 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.03 | 0.64 |
| 110145 | BRD-K27305650 | U2OS | 20 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |