CMap Candidate Details
Structure:
| CMap ID: | C03282 |
| Pert ID: | BRD-K92984783 |
| Compound Name: | melperone |
| Targets: | DRD2|HTR2A |
| MoA: | dopamine receptor antagonist; serotonin receptor antagonist |
| SMILES: | CC1CCN(CCCC(=O)c2ccc(F)cc2)CC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 2144 | BRD-K92984783 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2447 | BRD-K92984783 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.17 |
| 25545 | BRD-K92984783 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39834 | BRD-K92984783 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.19 | -0.63 | 0.01 |
| 40124 | BRD-K92984783 | HEPG2 | 10 uM | 6 h | -0.3 | -1.25 | 0.7 | 0.0 | 0.0 | 0.0 |
| 41257 | BRD-K92984783 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41595 | BRD-K92984783 | SKB | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128371 | BRD-K92984783 | A549 | 0.04 uM | 24 h | 0.24 | 0.98 | 0.09 | -0.36 | -1.22 | 1.24 |
| 128420 | BRD-K92984783 | HEK293 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.01 | 0.58 |
| 128471 | BRD-K92984783 | HELA | 1.11 uM | 24 h | -0.31 | -1.28 | 0.77 | 0.23 | 0.82 | 0.1 |
| 128493 | BRD-K92984783 | HT29 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.32 | 1.13 | 0.84 |
| 128530 | BRD-K92984783 | JURKAT | 10 uM | 24 h | -0.22 | -0.93 | 0.07 | -0.27 | -0.92 | 0.33 |
| 128623 | BRD-K92984783 | MDAMB231 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 128703 | BRD-K92984783 | THP1 | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.37 |
| 136164 | BRD-K92984783 | A375 | 0.08 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.22 | -0.74 | 0.06 |
| 136210 | BRD-K92984783 | HA1E | 0.03 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 136303 | BRD-K92984783 | MCF10A | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 136331 | BRD-K92984783 | MCF??7.00 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.31 | 1.09 | 0.67 |
| 136380 | BRD-K92984783 | YAPC | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |