CMap Candidate Details
Structure:
| CMap ID: | C03367 |
| Pert ID: | BRD-K33732501 |
| Compound Name: | methylnaltrexone |
| Targets: | OPRD1|OPRK1|OPRM1 |
| MoA: | opioid receptor antagonist |
| SMILES: | C[N@@+]1(CC2CC2)CC[C@@]23[C@H]4Oc5c2c(C[C@@H]1[C@@]3(O)CCC4=O)ccc5O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 95424 | BRD-K33732501 | U2OS | 10 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120527 | BRD-K33732501 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120563 | BRD-K33732501 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.26 | -0.89 | 0.26 |
| 120600 | BRD-K33732501 | HA1E | 0.125 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120666 | BRD-K33732501 | HT29 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120718 | BRD-K33732501 | JURKAT | 0.04 uM | 24 h | 0.27 | 1.12 | 0.26 | 0.0 | 0.0 | 0.0 |
| 120757 | BRD-K33732501 | MCF??7.00 | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120784 | BRD-K33732501 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 120827 | BRD-K33732501 | YAPC | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129037 | BRD-K33732501 | HELA | 2.22 uM | 3 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |