CMap Candidate Details
Structure:
| CMap ID: | C03495 |
| Pert ID: | BRD-K33892651 |
| Compound Name: | ML347 |
| Targets: | ACVR1|ACVRL1|BMPR1A |
| MoA: | ALK tyrosine kinase receptor inhibitor |
| SMILES: | COc1ccc(cc1)-c1cnc2c(cnn2c1)-c1cccc2ncccc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 96366 | BRD-K33892651 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 0.98 | 0.36 |
| 96437 | BRD-K33892651 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |