CMap Candidate Details
Structure:
| CMap ID: | C03713 |
| Pert ID: | BRD-K53123955 |
| Compound Name: | niridazole |
| Targets: | |
| MoA: | phosphofructokinase inhibitor |
| SMILES: | [O-][N+](=O)c1cnc(s1)N1CCNC1=O |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 6778 | BRD-K53123955 | A375 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7009 | BRD-K53123955 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 7463 | BRD-K53123955 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.1 | 0.88 |
| 7684 | BRD-K53123955 | HCC515 | 10 uM | 6 h | 0.23 | 0.96 | 0.08 | 0.0 | 0.0 | 0.0 |
| 8012 | BRD-K53123955 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 8207 | BRD-K53123955 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.28 | -0.94 | 0.38 |
| 8828 | BRD-K53123955 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51953 | BRD-K53123955 | PC3 | 10 uM | 6 h | 0.25 | 1.06 | 0.18 | 0.29 | 1.04 | 0.56 |
| 99643 | BRD-K53123955 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.25 | -0.84 | 0.17 |