CMap Candidate Details
Structure:
| CMap ID: | C03715 |
| Pert ID: | BRD-A84465106 |
| Compound Name: | nisoldipine |
| Targets: | CACNA1C|CACNA1D|CACNA1F|CACNA1S|CACNA2D1|CACNB2 |
| MoA: | calcium channel blocker |
| SMILES: | COC(=O)C1=C(C)NC(C)=C(C1c1ccccc1[N+]([O-])=O)C(=O)OCC(C)C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 51789 | BRD-A84465106 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.33 | -1.11 | 0.9 |
| 91100 | BRD-A84465106 | HUH7 | 8 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95486 | BRD-A84465106 | A549 | 10 uM | 24 h | -0.27 | -1.11 | 0.37 | 0.0 | 0.0 | 0.0 |
| 95577 | BRD-A84465106 | MCF??7.00 | 1.11 uM | 48 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 95698 | BRD-A84465106 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.32 | -1.08 | 0.8 |