CMap Candidate Details
Structure:
| CMap ID: | C03758 |
| Pert ID: | BRD-K92073408 |
| Compound Name: | norethindrone |
| Targets: | PGR |
| MoA: | progesterone receptor agonist |
| SMILES: | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@H]34)[C@@H]1CC[C@@]2(O)C#C |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 1659 | BRD-K92073408 | HA1E | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.9 | 0.29 |
| 2141 | BRD-K92073408 | HCC515 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2230 | BRD-K92073408 | PC3 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 2547 | BRD-K92073408 | VCAP | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.03 | 0.64 |
| 39224 | BRD-K92073408 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 39371 | BRD-K92073408 | A549 | 10 uM | 24 h | -0.26 | -1.08 | 0.29 | 0.0 | 0.0 | 0.0 |
| 39827 | BRD-K92073408 | ASC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40116 | BRD-K92073408 | HEPG2 | 10 uM | 6 h | -0.34 | -1.4 | 1.14 | 0.0 | 0.0 | 0.0 |
| 40377 | BRD-K92073408 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.26 | 0.9 | 0.22 |
| 40661 | BRD-K92073408 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 40925 | BRD-K92073408 | NEU | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 41249 | BRD-K92073408 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.4 | -1.33 | 1.75 |
| 91264 | BRD-K92073408 | HUH7 | 12 uM | 72 h | -0.26 | -1.07 | 0.28 | -0.29 | -0.97 | 0.44 |