CMap Candidate Details
Structure:
| CMap ID: | C03762 |
| Pert ID: | BRD-K11196887 |
| Compound Name: | norfloxacin |
| Targets: | TOP2A |
| MoA: | bacterial DNA gyrase inhibitor |
| SMILES: | CCn1cc(C(O)=O)c(=O)c2cc(F)c(cc12)N1CCNCC1 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 91286 | BRD-K11196887 | HUH7 | 10 uM | 72 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 100079 | BRD-K11196887 | U2OS | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.23 | 0.83 | 0.11 |
| 121205 | BRD-K11196887 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121240 | BRD-K11196887 | HA1E | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121257 | BRD-K11196887 | HELA | 0.04 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121296 | BRD-K11196887 | MCF??7.00 | 0.37 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121332 | BRD-K11196887 | PC3 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129251 | BRD-K11196887 | A375 | 0.74 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129318 | BRD-K11196887 | HT29 | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129390 | BRD-K11196887 | YAPC | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.3 | -1.03 | 0.62 |