CMap Candidate Details
Structure:
| CMap ID: | C04111 |
| Pert ID: | BRD-K92731339 |
| Compound Name: | perindopril |
| Targets: | ACE |
| MoA: | angiotensin converting enzyme inhibitor |
| SMILES: | CCC[C@H](N[C@@H](C)C(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C(O)=O)C(=O)OCC |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 5697 | BRD-K92731339 | HCC515 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.35 | 1.23 | 1.19 |
| 6602 | BRD-K92731339 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37418 | BRD-K92731339 | A549 | 10 uM | 6 h | 0.2 | 0.83 | 0.0 | 0.0 | 0.0 | 0.0 |
| 37762 | BRD-K92731339 | ASC | 10 uM | 24 h | -0.22 | -0.93 | 0.07 | 0.0 | 0.0 | 0.0 |
| 37959 | BRD-K92731339 | HEPG2 | 10 uM | 6 h | -0.22 | -0.92 | 0.06 | 0.0 | 0.0 | 0.0 |
| 38576 | BRD-K92731339 | NPC | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.02 | 0.49 |
| 38796 | BRD-K92731339 | PHH | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 96548 | BRD-K92731339 | PC3 | 3.33 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 121800 | BRD-K92731339 | HT29 | 0.37 uM | 24 h | 0.27 | 1.11 | 0.25 | 0.0 | 0.0 | 0.0 |
| 121821 | BRD-K92731339 | MCF??7.00 | 1.11 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.28 | 1.0 | 0.43 |
| 129762 | BRD-K92731339 | A375 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | -0.31 | -1.04 | 0.68 |
| 129798 | BRD-K92731339 | HA1E | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129839 | BRD-K92731339 | HEK293 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129877 | BRD-K92731339 | HELA | 2.22 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 129965 | BRD-K92731339 | MCF10A | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.04 | 0.55 |
| 130050 | BRD-K92731339 | MDAMB231 | 0.01 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130121 | BRD-K92731339 | THP1 | 0.25 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 130167 | BRD-K92731339 | YAPC | 2.22 uM | 24 h | -0.31 | -1.28 | 0.77 | 0.29 | 1.02 | 0.48 |