CMap Candidate Details
Structure:
| CMap ID: | C00414 |
| Pert ID: | BRD-A48261811 |
| Compound Name: | argatroban |
| Targets: | F2 |
| MoA: | thrombin inhibitor |
| SMILES: | C[C@@H]1CCN([C@H](C1)C(O)=O)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1cccc2CC(C)CNc12 |
| InchiKey: | |
| Compound Aliases: |
| Score ID | Pert ID | Cell Line | Pert Dose | Pert Time | Raw Score (GSE126848) | Normalized Score (GSE126848) | fdr_q_nlog10 (GSE126848) | Raw Score (GSE135251) | Normalized Score (GSE135251) | fdr_q_nlog10 (GSE135251) |
|---|---|---|---|---|---|---|---|---|---|---|
| 24387 | BRD-A48261811 | A375 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24533 | BRD-A48261811 | A549 | 10 uM | 24 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 24726 | BRD-A48261811 | HA1E | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.37 | 1.32 | 1.71 |
| 24846 | BRD-A48261811 | HT29 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 25070 | BRD-A48261811 | MCF??7.00 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.29 | 1.01 | 0.45 |
| 25474 | BRD-A48261811 | VCAP | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 | 0.0 |
| 51893 | BRD-A48261811 | PC3 | 10 uM | 6 h | 0.0 | 0.0 | 0.0 | -0.27 | -0.92 | 0.34 |